C17H24Br6N2O2 — CID 20741097
2,2,2-tribromo-N-[4-[[4-[(2,2,2-tribromoacetyl)amino]cyclohexyl]methyl]cyclohexyl]acetamide (PubChem CID 20741097) has the molecular formula C17H24Br6N2O2 and a molecular weight of 767.81 g/mol. Its IUPAC name is 2,2,2-tribromo-N-[4-[[4-[(2,2,2-tribromoacetyl)amino]cyclohexyl]methyl]cyclohexyl]acetamide.
| Compound Name | 2,2,2-tribromo-N-[4-[[4-[(2,2,2-tribromoacetyl)amino]cyclohexyl]methyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 20741097 |
| Molecular Formula | C17H24Br6N2O2 |
| Molecular Weight | 767.81 g/mol |
| Exact Mass | 761.69 |
| IUPAC Name | 2,2,2-tribromo-N-[4-[[4-[(2,2,2-tribromoacetyl)amino]cyclohexyl]methyl]cyclohexyl]acetamide |
| SMILES | O=C(NC1CCC(CC2CCC(NC(=O)C(Br)(Br)Br)CC2)CC1)C(Br)(Br)Br |
| InChI | InChI=1S/C17H24Br6N2O2/c18-16(19,20)14(26)24-12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)25-15(27)17(21,22)23/h10-13H,1-9H2,(H,24,26)(H,25,27) |
| InChIKey | OLDJPFUUDKDUJN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.81 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|