About 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten
2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten (PubChem CID 20741223) has the molecular formula C13H17N4W4-
and a molecular weight of 964.67 g/mol. Its IUPAC name is 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten.
Molecular Properties
| Compound Name | 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten |
| PubChem CID | 20741223 |
| Molecular Formula | C13H17N4W4- |
| Molecular Weight | 964.67 g/mol |
| Exact Mass | 964.95 |
| IUPAC Name | 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten |
| SMILES | CCCCc1[c-]c(C/N=C(\N)NC#N)ccc1.[W].[W].[W].[W] |
| InChI | InChI=1S/C13H17N4.4W/c1-2-3-5-11-6-4-7-12(8-11)9-16-13(15)17-10-14;;;;/h4,6-7H,2-3,5,9H2,1H3,(H3,15,16,17);;;;/q-1;;;; |
| InChIKey | DHRAQIAQNHFLNK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 964.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten?
The IUPAC name of 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten (CID 20741223) is 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten.
What is the SMILES notation for 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten?
The canonical SMILES for 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten is CCCCc1[c-]c(C/N=C(\N)NC#N)ccc1.[W].[W].[W].[W].
What is the InChIKey of 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten?
The InChIKey is DHRAQIAQNHFLNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N4.4W/c1-2-3-5-11-6-4-7-12(8-11)9-16-13(15)17-10-14;;;;/h4,6-7H,2-3,5,9H2,1H3,(H3,15,16,17);;;;/q-1;;;;.
What are the key properties of 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten?
2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten has a molecular weight of 964.67 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-butylbenzene-2-id-1-yl)methyl]-1-cyanoguanidine;tungsten is sourced from PubChem (CID 20741223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).