About actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide]
actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide] (PubChem CID 20741308) has the molecular formula C14H17AcN2-
and a molecular weight of 440.30 g/mol. Its IUPAC name is actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide].
Molecular Properties
| Compound Name | actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide] |
| PubChem CID | 20741308 |
| Molecular Formula | C14H17AcN2- |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide] |
| SMILES | CC1=CC2(CC[N-]CC2)Nc2ccccc21.[Ac] |
| InChI | InChI=1S/C14H17N2.Ac/c1-11-10-14(6-8-15-9-7-14)16-13-5-3-2-4-12(11)13;/h2-5,10,16H,6-9H2,1H3;/q-1; |
| InChIKey | CNCYXUFNCRZLQB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide]?
The IUPAC name of actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide] (CID 20741308) is actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide].
What is the SMILES notation for actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide]?
The canonical SMILES for actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide] is CC1=CC2(CC[N-]CC2)Nc2ccccc21.[Ac].
What is the InChIKey of actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide]?
The InChIKey is CNCYXUFNCRZLQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N2.Ac/c1-11-10-14(6-8-15-9-7-14)16-13-5-3-2-4-12(11)13;/h2-5,10,16H,6-9H2,1H3;/q-1;.
What are the key properties of actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide]?
actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide] has a molecular weight of 440.30 g/mol, XLogP of 3.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;4-methylspiro[1H-quinoline-2,4'-piperidin-1-ide] is sourced from PubChem (CID 20741308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).