About N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine
N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine (PubChem CID 20741385) has the molecular formula C14H12N4S
and a molecular weight of 268.35 g/mol. Its IUPAC name is N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine |
| PubChem CID | 20741385 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine |
| SMILES | Cc1cccc(Nc2nccc(-c3nccs3)n2)c1 |
| InChI | InChI=1S/C14H12N4S/c1-10-3-2-4-11(9-10)17-14-16-6-5-12(18-14)13-15-7-8-19-13/h2-9H,1H3,(H,16,17,18) |
| InChIKey | NYGKSLDYPFTJBU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine?
The IUPAC name of N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine (CID 20741385) is N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine.
What is the SMILES notation for N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine?
The canonical SMILES for N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine is Cc1cccc(Nc2nccc(-c3nccs3)n2)c1.
What is the InChIKey of N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine?
The InChIKey is NYGKSLDYPFTJBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4S/c1-10-3-2-4-11(9-10)17-14-16-6-5-12(18-14)13-15-7-8-19-13/h2-9H,1H3,(H,16,17,18).
What are the key properties of N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine?
N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine has a molecular weight of 268.35 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine is sourced from PubChem (CID 20741385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).