C20H21Cl2NOS — CID 20741527
(4aS,9bR)-8-(2,4-dichlorophenyl)-6-propan-2-ylsulfanyl-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-c]pyridine (PubChem CID 20741527) has the molecular formula C20H21Cl2NOS and a molecular weight of 394.37 g/mol. Its IUPAC name is (4aS,9bR)-8-(2,4-dichlorophenyl)-6-propan-2-ylsulfanyl-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-c]pyridine.
| Compound Name | (4aS,9bR)-8-(2,4-dichlorophenyl)-6-propan-2-ylsulfanyl-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 20741527 |
| Molecular Formula | C20H21Cl2NOS |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (4aS,9bR)-8-(2,4-dichlorophenyl)-6-propan-2-ylsulfanyl-1,2,3,4,4a,9b-hexahydro-[1]benzofuro[3,2-c]pyridine |
| SMILES | CC(C)Sc1cc(-c2ccc(Cl)cc2Cl)cc2c1O[C@H]1CCNC[C@@H]21 |
| InChI | InChI=1S/C20H21Cl2NOS/c1-11(2)25-19-8-12(14-4-3-13(21)9-17(14)22)7-15-16-10-23-6-5-18(16)24-20(15)19/h3-4,7-9,11,16,18,23H,5-6,10H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | MGUZVHRIRRODJR-WMZOPIPTSA-N |
| XLogP | 6.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |