C34H53N7O11 — CID 20741646
2-[[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetyl]-[2-[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetyl]oxyethyl]amino]ethyl 2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetate (PubChem CID 20741646) has the molecular formula C34H53N7O11 and a molecular weight of 735.84 g/mol. Its IUPAC name is 2-[[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetyl]-[2-[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetyl]oxyethyl]amino]ethyl 2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetate.
| Compound Name | 2-[[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetyl]-[2-[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetyl]oxyethyl]amino]ethyl 2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 20741646 |
| Molecular Formula | C34H53N7O11 |
| Molecular Weight | 735.84 g/mol |
| Exact Mass | 735.38 |
| IUPAC Name | 2-[[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetyl]-[2-[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetyl]oxyethyl]amino]ethyl 2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)acetate |
| SMILES | CC1(C)NC(C)(C)C(=O)N(CC(=O)OCCN(CCOC(=O)CN2C(=O)C(C)(C)NC(C)(C)C2=O)C(=O)CN2C(=O)C(C)(C)NC(C)(C)C2=O)C1=O |
| InChI | InChI=1S/C34H53N7O11/c1-29(2)23(45)39(24(46)30(3,4)35-29)17-20(42)38(13-15-51-21(43)18-40-25(47)31(5,6)36-32(7,8)26(40)48)14-16-52-22(44)19-41-27(49)33(9,10)37-34(11,12)28(41)50/h35-37H,13-19H2,1-12H3 |
| InChIKey | DZUFJYJRFGZPGR-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 221.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.84 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|