C21H35N5O5 — CID 20741664
N,N-bis[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)ethyl]formamide (PubChem CID 20741664) has the molecular formula C21H35N5O5 and a molecular weight of 437.54 g/mol. Its IUPAC name is N,N-bis[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)ethyl]formamide.
| Compound Name | N,N-bis[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)ethyl]formamide |
|---|---|
| PubChem CID | 20741664 |
| Molecular Formula | C21H35N5O5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N,N-bis[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)ethyl]formamide |
| SMILES | CC1(C)NC(C)(C)C(=O)N(CCN(C=O)CCN2C(=O)C(C)(C)NC(C)(C)C2=O)C1=O |
| InChI | InChI=1S/C21H35N5O5/c1-18(2)14(28)25(15(29)19(3,4)22-18)11-9-24(13-27)10-12-26-16(30)20(5,6)23-21(7,8)17(26)31/h13,22-23H,9-12H2,1-8H3 |
| InChIKey | DLLZYJDKLHJHEN-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|