About 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol
3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol (PubChem CID 20741954) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol.
Molecular Properties
| Compound Name | 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol |
| PubChem CID | 20741954 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol |
| SMILES | CC(C)C(O)(C(C)C)[C@@H]1CCN1 |
| InChI | InChI=1S/C10H21NO/c1-7(2)10(12,8(3)4)9-5-6-11-9/h7-9,11-12H,5-6H2,1-4H3/t9-/m0/s1 |
| InChIKey | WNMUOGVCZAHGDA-VIFPVBQESA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol?
The IUPAC name of 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol (CID 20741954) is 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol.
What is the SMILES notation for 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol?
The canonical SMILES for 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol is CC(C)C(O)(C(C)C)[C@@H]1CCN1.
What is the InChIKey of 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol?
The InChIKey is WNMUOGVCZAHGDA-VIFPVBQESA-N. The full InChI is InChI=1S/C10H21NO/c1-7(2)10(12,8(3)4)9-5-6-11-9/h7-9,11-12H,5-6H2,1-4H3/t9-/m0/s1.
What are the key properties of 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol?
3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol has a molecular weight of 171.28 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-azetidin-2-yl]-2,4-dimethylpentan-3-ol is sourced from PubChem (CID 20741954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).