C33H32F4N2O6 — CID 20742261
3-[[4-[2-(4-cyclohexylphenyl)-3-oxo-3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)amino]propyl]benzoyl]amino]propanoic acid (PubChem CID 20742261) has the molecular formula C33H32F4N2O6 and a molecular weight of 628.62 g/mol. Its IUPAC name is 3-[[4-[2-(4-cyclohexylphenyl)-3-oxo-3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)amino]propyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[2-(4-cyclohexylphenyl)-3-oxo-3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)amino]propyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20742261 |
| Molecular Formula | C33H32F4N2O6 |
| Molecular Weight | 628.62 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | 3-[[4-[2-(4-cyclohexylphenyl)-3-oxo-3-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)amino]propyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CC(C(=O)Nc2ccc3c(c2)OC(F)(F)C(F)(F)O3)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C33H32F4N2O6/c34-32(35)33(36,37)45-28-19-25(14-15-27(28)44-32)39-31(43)26(23-12-10-22(11-13-23)21-4-2-1-3-5-21)18-20-6-8-24(9-7-20)30(42)38-17-16-29(40)41/h6-15,19,21,26H,1-5,16-18H2,(H,38,42)(H,39,43)(H,40,41) |
| InChIKey | ABJMNPZBURYBNJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|