C30H24F3NO6 — CID 20742372
3-[[4-[(Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-oxo-4-[3-(trifluoromethoxy)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid (PubChem CID 20742372) has the molecular formula C30H24F3NO6 and a molecular weight of 551.52 g/mol. Its IUPAC name is 3-[[4-[(Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-oxo-4-[3-(trifluoromethoxy)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-oxo-4-[3-(trifluoromethoxy)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20742372 |
| Molecular Formula | C30H24F3NO6 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 3-[[4-[(Z)-2-(2,3-dihydro-1H-inden-5-yl)-4-oxo-4-[3-(trifluoromethoxy)phenyl]but-2-enoyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(C(=O)/C(=C\C(=O)c2cccc(OC(F)(F)F)c2)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C30H24F3NO6/c31-30(32,33)40-24-6-2-5-23(16-24)26(35)17-25(22-12-7-18-3-1-4-21(18)15-22)28(38)19-8-10-20(11-9-19)29(39)34-14-13-27(36)37/h2,5-12,15-17H,1,3-4,13-14H2,(H,34,39)(H,36,37)/b25-17- |
| InChIKey | FIFMMAUWACNBMF-UQQQWYQISA-N |
| XLogP | 5.43 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|