About 3-methyl-1,1-dipropylcyclobutane
3-methyl-1,1-dipropylcyclobutane (PubChem CID 20742502) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is 3-methyl-1,1-dipropylcyclobutane.
Molecular Properties
| Compound Name | 3-methyl-1,1-dipropylcyclobutane |
| PubChem CID | 20742502 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 3-methyl-1,1-dipropylcyclobutane |
| SMILES | CCCC1(CCC)CC(C)C1 |
| InChI | InChI=1S/C11H22/c1-4-6-11(7-5-2)8-10(3)9-11/h10H,4-9H2,1-3H3 |
| InChIKey | RRBPFMIMAHILPE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-1,1-dipropylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,1-dipropylcyclobutane?
The IUPAC name of 3-methyl-1,1-dipropylcyclobutane (CID 20742502) is 3-methyl-1,1-dipropylcyclobutane.
What is the SMILES notation for 3-methyl-1,1-dipropylcyclobutane?
The canonical SMILES for 3-methyl-1,1-dipropylcyclobutane is CCCC1(CCC)CC(C)C1.
What is the InChIKey of 3-methyl-1,1-dipropylcyclobutane?
The InChIKey is RRBPFMIMAHILPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22/c1-4-6-11(7-5-2)8-10(3)9-11/h10H,4-9H2,1-3H3.
What are the key properties of 3-methyl-1,1-dipropylcyclobutane?
3-methyl-1,1-dipropylcyclobutane has a molecular weight of 154.30 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,1-dipropylcyclobutane is sourced from PubChem (CID 20742502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).