About (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate
(2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate (PubChem CID 20742508) has the molecular formula C15H20F2O2
and a molecular weight of 270.32 g/mol. Its IUPAC name is (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate |
| PubChem CID | 20742508 |
| Molecular Formula | C15H20F2O2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)OC2=C(F)C(F)C(C)C=C2)CC1 |
| InChI | InChI=1S/C15H20F2O2/c1-9-3-6-11(7-4-9)15(18)19-12-8-5-10(2)13(16)14(12)17/h5,8-11,13H,3-4,6-7H2,1-2H3 |
| InChIKey | HANFGHMSANDNDV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate?
The IUPAC name of (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate (CID 20742508) is (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate.
What is the SMILES notation for (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate?
The canonical SMILES for (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate is CC1CCC(C(=O)OC2=C(F)C(F)C(C)C=C2)CC1.
What is the InChIKey of (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate?
The InChIKey is HANFGHMSANDNDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2O2/c1-9-3-6-11(7-4-9)15(18)19-12-8-5-10(2)13(16)14(12)17/h5,8-11,13H,3-4,6-7H2,1-2H3.
What are the key properties of (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate?
(2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate has a molecular weight of 270.32 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluoro-4-methylcyclohexa-1,5-dien-1-yl) 4-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 20742508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).