C25H33F15O4 — CID 20742584
6-O-tert-butyl 1-O-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl) 2-ethyl-2,3,3,5,5-pentamethylhexanedioate (PubChem CID 20742584) has the molecular formula C25H33F15O4 and a molecular weight of 682.50 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl) 2-ethyl-2,3,3,5,5-pentamethylhexanedioate.
| Compound Name | 6-O-tert-butyl 1-O-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl) 2-ethyl-2,3,3,5,5-pentamethylhexanedioate |
|---|---|
| PubChem CID | 20742584 |
| Molecular Formula | C25H33F15O4 |
| Molecular Weight | 682.50 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | 6-O-tert-butyl 1-O-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl) 2-ethyl-2,3,3,5,5-pentamethylhexanedioate |
| SMILES | CCC(C)(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)CC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H33F15O4/c1-10-18(9,17(7,8)11-16(5,6)13(41)44-15(2,3)4)14(42)43-12-19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)40/h10-12H2,1-9H3 |
| InChIKey | ZOJDFRRLCDPFMI-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.50 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|