C6H4F8O — CID 20742585
2,2,3,3,4,4,5,5-octafluoro-1-methylcyclopentan-1-ol (PubChem CID 20742585) has the molecular formula C6H4F8O and a molecular weight of 244.08 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1-methylcyclopentan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 20742585 |
| Molecular Formula | C6H4F8O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1-methylcyclopentan-1-ol |
| SMILES | CC1(O)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H4F8O/c1-2(15)3(7,8)5(11,12)6(13,14)4(2,9)10/h15H,1H3 |
| InChIKey | CNBCPVKUHRJAFT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|