About 6-methyltetrazolo[1,5-b]pyridazine
6-methyltetrazolo[1,5-b]pyridazine (PubChem CID 20742984) has the molecular formula C5H5N5
and a molecular weight of 135.13 g/mol. Its IUPAC name is 6-methyltetrazolo[1,5-b]pyridazine.
Molecular Properties
| Compound Name | 6-methyltetrazolo[1,5-b]pyridazine |
| PubChem CID | 20742984 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 6-methyltetrazolo[1,5-b]pyridazine |
| SMILES | Cc1ccc2nnnn2n1 |
| InChI | InChI=1S/C5H5N5/c1-4-2-3-5-6-8-9-10(5)7-4/h2-3H,1H3 |
| InChIKey | QLEQWMSXFPJNDM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyltetrazolo[1,5-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyltetrazolo[1,5-b]pyridazine?
The IUPAC name of 6-methyltetrazolo[1,5-b]pyridazine (CID 20742984) is 6-methyltetrazolo[1,5-b]pyridazine.
What is the SMILES notation for 6-methyltetrazolo[1,5-b]pyridazine?
The canonical SMILES for 6-methyltetrazolo[1,5-b]pyridazine is Cc1ccc2nnnn2n1.
What is the InChIKey of 6-methyltetrazolo[1,5-b]pyridazine?
The InChIKey is QLEQWMSXFPJNDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5/c1-4-2-3-5-6-8-9-10(5)7-4/h2-3H,1H3.
What are the key properties of 6-methyltetrazolo[1,5-b]pyridazine?
6-methyltetrazolo[1,5-b]pyridazine has a molecular weight of 135.13 g/mol, XLogP of -0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyltetrazolo[1,5-b]pyridazine is sourced from PubChem (CID 20742984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).