C18H24F6O4S — CID 20743853
methyl 7-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]octane-3-sulfonate (PubChem CID 20743853) has the molecular formula C18H24F6O4S and a molecular weight of 450.44 g/mol. Its IUPAC name is methyl 7-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]octane-3-sulfonate.
| Compound Name | methyl 7-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]octane-3-sulfonate |
|---|---|
| PubChem CID | 20743853 |
| Molecular Formula | C18H24F6O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | methyl 7-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]octane-3-sulfonate |
| SMILES | CCC(CCCC(C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)S(=O)(=O)OC |
| InChI | InChI=1S/C18H24F6O4S/c1-4-15(29(26,27)28-3)7-5-6-12(2)13-8-10-14(11-9-13)16(25,17(19,20)21)18(22,23)24/h8-12,15,25H,4-7H2,1-3H3 |
| InChIKey | COWNBPABQSLGBZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|