C12H11F13O — CID 20743869
1,1,1,3,3,3-hexafluoro-2-[1,2,2,3,6,6-hexafluoro-3-(fluoromethyl)-4,5-dimethylcyclohexyl]propan-2-ol (PubChem CID 20743869) has the molecular formula C12H11F13O and a molecular weight of 418.19 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[1,2,2,3,6,6-hexafluoro-3-(fluoromethyl)-4,5-dimethylcyclohexyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[1,2,2,3,6,6-hexafluoro-3-(fluoromethyl)-4,5-dimethylcyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 20743869 |
| Molecular Formula | C12H11F13O |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[1,2,2,3,6,6-hexafluoro-3-(fluoromethyl)-4,5-dimethylcyclohexyl]propan-2-ol |
| SMILES | CC1C(C)C(F)(CF)C(F)(F)C(F)(C(O)(C(F)(F)F)C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C12H11F13O/c1-4-5(2)7(15,16)8(17,10(18,19)6(4,14)3-13)9(26,11(20,21)22)12(23,24)25/h4-5,26H,3H2,1-2H3 |
| InChIKey | URQPAHRBLZKZCB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |