C12H13F11O — CID 20743870
1,1,1,3,3,3-hexafluoro-2-[1,2,2,6-tetrafluoro-3-(fluoromethyl)-4,5-dimethylcyclohexyl]propan-2-ol (PubChem CID 20743870) has the molecular formula C12H13F11O and a molecular weight of 382.21 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[1,2,2,6-tetrafluoro-3-(fluoromethyl)-4,5-dimethylcyclohexyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[1,2,2,6-tetrafluoro-3-(fluoromethyl)-4,5-dimethylcyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 20743870 |
| Molecular Formula | C12H13F11O |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[1,2,2,6-tetrafluoro-3-(fluoromethyl)-4,5-dimethylcyclohexyl]propan-2-ol |
| SMILES | CC1C(C)C(F)C(F)(C(O)(C(F)(F)F)C(F)(F)F)C(F)(F)C1CF |
| InChI | InChI=1S/C12H13F11O/c1-4-5(2)7(14)8(15,9(16,17)6(4)3-13)10(24,11(18,19)20)12(21,22)23/h4-7,24H,3H2,1-2H3 |
| InChIKey | XPPJOGPAKMZAMD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |