C12H13F9O — CID 20743871
1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-ol (PubChem CID 20743871) has the molecular formula C12H13F9O and a molecular weight of 344.22 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-ol |
|---|---|
| PubChem CID | 20743871 |
| Molecular Formula | C12H13F9O |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-ol |
| SMILES | CC1C(C)C2CC1C(F)(F)C2(F)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H13F9O/c1-4-5(2)7-3-6(4)8(13,9(7,14)15)10(22,11(16,17)18)12(19,20)21/h4-7,22H,3H2,1-2H3 |
| InChIKey | JVHLYPFATVQWQI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |