C12H15F7O — CID 20743873
1,1,1,3,3,3-hexafluoro-2-(2-fluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-ol (PubChem CID 20743873) has the molecular formula C12H15F7O and a molecular weight of 308.24 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2-fluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2-fluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-ol |
|---|---|
| PubChem CID | 20743873 |
| Molecular Formula | C12H15F7O |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2-fluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-ol |
| SMILES | CC1C2CC(C1C)C(F)(C(O)(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C12H15F7O/c1-5-6(2)8-3-7(5)4-9(8,13)10(20,11(14,15)16)12(17,18)19/h5-8,20H,3-4H2,1-2H3 |
| InChIKey | OADSAQUTQUTGDZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |