C26H38F12O3 — CID 20743878
1-[2-(2-butan-2-yloxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-[2-(2-cyclohexylethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexane (PubChem CID 20743878) has the molecular formula C26H38F12O3 and a molecular weight of 626.56 g/mol. Its IUPAC name is 1-[2-(2-butan-2-yloxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-[2-(2-cyclohexylethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexane.
| Compound Name | 1-[2-(2-butan-2-yloxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-[2-(2-cyclohexylethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexane |
|---|---|
| PubChem CID | 20743878 |
| Molecular Formula | C26H38F12O3 |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | 1-[2-(2-butan-2-yloxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-[2-(2-cyclohexylethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexane |
| SMILES | CCC(C)OCCOC(C1CCC(C(OCCC2CCCCC2)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H38F12O3/c1-3-17(2)39-15-16-41-22(25(33,34)35,26(36,37)38)20-11-9-19(10-12-20)21(23(27,28)29,24(30,31)32)40-14-13-18-7-5-4-6-8-18/h17-20H,3-16H2,1-2H3 |
| InChIKey | ZVKADXQKHYMUEW-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|