C22H36F6O2 — CID 20743880
5-[1,1,1,3,3,3-hexafluoro-2-(nonoxymethoxy)propan-2-yl]-2,3-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743880) has the molecular formula C22H36F6O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-(nonoxymethoxy)propan-2-yl]-2,3-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-(nonoxymethoxy)propan-2-yl]-2,3-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743880 |
| Molecular Formula | C22H36F6O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-(nonoxymethoxy)propan-2-yl]-2,3-dimethylbicyclo[2.2.1]heptane |
| SMILES | CCCCCCCCCOCOC(C1CC2CC1C(C)C2C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H36F6O2/c1-4-5-6-7-8-9-10-11-29-14-30-20(21(23,24)25,22(26,27)28)19-13-17-12-18(19)16(3)15(17)2/h15-19H,4-14H2,1-3H3 |
| InChIKey | AXAIYDMJZFFVNP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|