C25H35F9O2 — CID 20743913
2-[2-[(2-cyclohexylcyclohexyl)oxymethoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3,3-trifluoro-5,6-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743913) has the molecular formula C25H35F9O2 and a molecular weight of 538.54 g/mol. Its IUPAC name is 2-[2-[(2-cyclohexylcyclohexyl)oxymethoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3,3-trifluoro-5,6-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 2-[2-[(2-cyclohexylcyclohexyl)oxymethoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3,3-trifluoro-5,6-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743913 |
| Molecular Formula | C25H35F9O2 |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 2-[2-[(2-cyclohexylcyclohexyl)oxymethoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3,3-trifluoro-5,6-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC1C(C)C2CC1C(F)(F)C2(F)C(OCOC1CCCCC1C1CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H35F9O2/c1-14-15(2)19-12-18(14)21(26,22(19,27)28)23(24(29,30)31,25(32,33)34)36-13-35-20-11-7-6-10-17(20)16-8-4-3-5-9-16/h14-20H,3-13H2,1-2H3 |
| InChIKey | XXFBNPMGSCDSQB-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|