C12H15F9O — CID 20743915
2-[1,2-difluoro-5-(fluoromethyl)-3,4-dimethylcyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 20743915) has the molecular formula C12H15F9O and a molecular weight of 346.23 g/mol. Its IUPAC name is 2-[1,2-difluoro-5-(fluoromethyl)-3,4-dimethylcyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[1,2-difluoro-5-(fluoromethyl)-3,4-dimethylcyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 20743915 |
| Molecular Formula | C12H15F9O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[1,2-difluoro-5-(fluoromethyl)-3,4-dimethylcyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC1C(CF)CC(F)(C(O)(C(F)(F)F)C(F)(F)F)C(F)C1C |
| InChI | InChI=1S/C12H15F9O/c1-5-6(2)8(14)9(15,3-7(5)4-13)10(22,11(16,17)18)12(19,20)21/h5-8,22H,3-4H2,1-2H3 |
| InChIKey | HBZHUBHIWPSQAQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |