C17H20F12O3 — CID 20743919
[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-methylbutanoate (PubChem CID 20743919) has the molecular formula C17H20F12O3 and a molecular weight of 500.32 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-methylbutanoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 20743919 |
| Molecular Formula | C17H20F12O3 |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H20F12O3/c1-3-8(2)11(30)32-13(16(24,25)26,17(27,28)29)10-6-4-9(5-7-10)12(31,14(18,19)20)15(21,22)23/h8-10,31H,3-7H2,1-2H3 |
| InChIKey | ZEPFRPGDLUHDSO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |