C26H32F12O4 — CID 20743922
[1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(octoxymethoxy)propan-2-yl]phenyl]propan-2-yl] 2-methylbutanoate (PubChem CID 20743922) has the molecular formula C26H32F12O4 and a molecular weight of 636.51 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(octoxymethoxy)propan-2-yl]phenyl]propan-2-yl] 2-methylbutanoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(octoxymethoxy)propan-2-yl]phenyl]propan-2-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 20743922 |
| Molecular Formula | C26H32F12O4 |
| Molecular Weight | 636.51 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(octoxymethoxy)propan-2-yl]phenyl]propan-2-yl] 2-methylbutanoate |
| SMILES | CCCCCCCCOCOC(c1ccc(C(OC(=O)C(C)CC)(C(F)(F)F)C(F)(F)F)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H32F12O4/c1-4-6-7-8-9-10-15-40-16-41-21(23(27,28)29,24(30,31)32)18-11-13-19(14-12-18)22(25(33,34)35,26(36,37)38)42-20(39)17(3)5-2/h11-14,17H,4-10,15-16H2,1-3H3 |
| InChIKey | CPANCUYTYXLEBP-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.51 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|