C23H33F9O2 — CID 20743924
2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743924) has the molecular formula C23H33F9O2 and a molecular weight of 512.50 g/mol. Its IUPAC name is 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743924 |
| Molecular Formula | C23H33F9O2 |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC1CCC(C(C)C)C(OCOC(C(F)(F)F)(C(F)(F)F)C2(F)C3CC(C(C)C3C)C2(F)F)C1 |
| InChI | InChI=1S/C23H33F9O2/c1-11(2)15-7-6-12(3)8-18(15)33-10-34-21(22(27,28)29,23(30,31)32)19(24)16-9-17(20(19,25)26)14(5)13(16)4/h11-18H,6-10H2,1-5H3 |
| InChIKey | VGMDUSAGALXHAO-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|