C17H26F6O3 — CID 20743926
2,3-dimethyl-5-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]bicyclo[2.2.1]heptane (PubChem CID 20743926) has the molecular formula C17H26F6O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2,3-dimethyl-5-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]bicyclo[2.2.1]heptane.
| Compound Name | 2,3-dimethyl-5-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743926 |
| Molecular Formula | C17H26F6O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2,3-dimethyl-5-[3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)-2-(trifluoromethyl)propyl]bicyclo[2.2.1]heptane |
| SMILES | COCCOCOC(CC1CC2CC1C(C)C2C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H26F6O3/c1-10-11(2)14-7-12(10)6-13(14)8-15(16(18,19)20,17(21,22)23)26-9-25-5-4-24-3/h10-14H,4-9H2,1-3H3 |
| InChIKey | KHGVQJBWTWUGTF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|