C23H35F7O2 — CID 20743931
2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743931) has the molecular formula C23H35F7O2 and a molecular weight of 476.52 g/mol. Its IUPAC name is 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743931 |
| Molecular Formula | C23H35F7O2 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC1CCC(C(C)C)C(OCOC(C(F)(F)F)(C(F)(F)F)C2(F)CC3CC2C(C)C3C)C1 |
| InChI | InChI=1S/C23H35F7O2/c1-12(2)17-7-6-13(3)8-19(17)31-11-32-21(22(25,26)27,23(28,29)30)20(24)10-16-9-18(20)15(5)14(16)4/h12-19H,6-11H2,1-5H3 |
| InChIKey | QSUVNVYDYMXYGK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|