C16H23F7O3 — CID 20743932
2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743932) has the molecular formula C16H23F7O3 and a molecular weight of 396.34 g/mol. Its IUPAC name is 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743932 |
| Molecular Formula | C16H23F7O3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
| SMILES | COCCOCOC(C(F)(F)F)(C(F)(F)F)C1(F)CC2CC1C(C)C2C |
| InChI | InChI=1S/C16H23F7O3/c1-9-10(2)12-6-11(9)7-13(12,17)14(15(18,19)20,16(21,22)23)26-8-25-5-4-24-3/h9-12H,4-8H2,1-3H3 |
| InChIKey | UMNCFALHNXAMMM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|