C14H19F7O2 — CID 20743933
2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743933) has the molecular formula C14H19F7O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743933 |
| Molecular Formula | C14H19F7O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-fluoro-2-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-5,6-dimethylbicyclo[2.2.1]heptane |
| SMILES | COCOC(C(F)(F)F)(C(F)(F)F)C1(F)CC2CC1C(C)C2C |
| InChI | InChI=1S/C14H19F7O2/c1-7-8(2)10-4-9(7)5-11(10,15)12(13(16,17)18,14(19,20)21)23-6-22-3/h7-10H,4-6H2,1-3H3 |
| InChIKey | YZQZHZBKIFJALD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|