C20H30F6O2 — CID 20743940
5-[2-(cyclohexylmethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743940) has the molecular formula C20H30F6O2 and a molecular weight of 416.45 g/mol. Its IUPAC name is 5-[2-(cyclohexylmethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 5-[2-(cyclohexylmethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743940 |
| Molecular Formula | C20H30F6O2 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 5-[2-(cyclohexylmethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2,3-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC1C2CC(C1C)C(C(OCOCC1CCCCC1)(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C20H30F6O2/c1-12-13(2)16-8-15(12)9-17(16)18(19(21,22)23,20(24,25)26)28-11-27-10-14-6-4-3-5-7-14/h12-17H,3-11H2,1-2H3 |
| InChIKey | GKXATKVLGIBUBX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|