C16H24F6O2 — CID 20743942
5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,3-dimethylbicyclo[2.2.1]heptane (PubChem CID 20743942) has the molecular formula C16H24F6O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,3-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,3-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20743942 |
| Molecular Formula | C16H24F6O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,3-dimethylbicyclo[2.2.1]heptane |
| SMILES | CCOCOC(CC1CC2CC1C(C)C2C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H24F6O2/c1-4-23-8-24-14(15(17,18)19,16(20,21)22)7-12-5-11-6-13(12)10(3)9(11)2/h9-13H,4-8H2,1-3H3 |
| InChIKey | YBBAGAHXDBCQQY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|