C23H32F6O3 — CID 20743947
tert-butyl [2-[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] carbonate (PubChem CID 20743947) has the molecular formula C23H32F6O3 and a molecular weight of 470.49 g/mol. Its IUPAC name is tert-butyl [2-[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] carbonate.
| Compound Name | tert-butyl [2-[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] carbonate |
|---|---|
| PubChem CID | 20743947 |
| Molecular Formula | C23H32F6O3 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | tert-butyl [2-[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] carbonate |
| SMILES | CC1C(C)C2CC1C1C3CC(CC(OC(=O)OC(C)(C)C)(C(F)(F)F)C(F)(F)F)C(C3)C21 |
| InChI | InChI=1S/C23H32F6O3/c1-10-11(2)15-8-14(10)17-12-6-13(16(7-12)18(15)17)9-21(22(24,25)26,23(27,28)29)32-19(30)31-20(3,4)5/h10-18H,6-9H2,1-5H3 |
| InChIKey | FOKQTSBJFWWSNI-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|