C25H36F6O2 — CID 20743948
9-[2-(cyclohexylmethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 20743948) has the molecular formula C25H36F6O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 9-[2-(cyclohexylmethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 9-[2-(cyclohexylmethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 20743948 |
| Molecular Formula | C25H36F6O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 9-[2-(cyclohexylmethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC1C(C)C2CC1C1C3CC(C21)C(C(OCOCC1CCCCC1)(C(F)(F)F)C(F)(F)F)C3 |
| InChI | InChI=1S/C25H36F6O2/c1-13-14(2)18-10-17(13)21-16-8-19(22(18)21)20(9-16)23(24(26,27)28,25(29,30)31)33-12-32-11-15-6-4-3-5-7-15/h13-22H,3-12H2,1-2H3 |
| InChIKey | AOZVMXHPLBGMHC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|