C28H39F9O2 — CID 20743953
4,4,5-trifluoro-5-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 20743953) has the molecular formula C28H39F9O2 and a molecular weight of 578.60 g/mol. Its IUPAC name is 4,4,5-trifluoro-5-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4,4,5-trifluoro-5-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 20743953 |
| Molecular Formula | C28H39F9O2 |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 4,4,5-trifluoro-5-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethoxy]propan-2-yl]-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC1CCC(C(C)C)C(OCOC(C(F)(F)F)(C(F)(F)F)C2(F)C3CC(C4C5CC(C(C)C5C)C43)C2(F)F)C1 |
| InChI | InChI=1S/C28H39F9O2/c1-12(2)16-7-6-13(3)8-21(16)38-11-39-26(27(32,33)34,28(35,36)37)24(29)19-10-20(25(24,30)31)23-18-9-17(22(19)23)14(4)15(18)5/h12-23H,6-11H2,1-5H3 |
| InChIKey | SQQXZVJUBNXKIH-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|