C20H27F7O2 — CID 20743955
4-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-fluoro-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 20743955) has the molecular formula C20H27F7O2 and a molecular weight of 432.42 g/mol. Its IUPAC name is 4-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-fluoro-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-fluoro-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 20743955 |
| Molecular Formula | C20H27F7O2 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 4-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-fluoro-9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CCOCOC(C(F)(F)F)(C(F)(F)F)C1(F)CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C20H27F7O2/c1-4-28-8-29-18(19(22,23)24,20(25,26)27)17(21)7-11-5-14(17)16-13-6-12(15(11)16)9(2)10(13)3/h9-16H,4-8H2,1-3H3 |
| InChIKey | HHBFBDUIXBDSIX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|