C21H30F6O2 — CID 20743956
9-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 20743956) has the molecular formula C21H30F6O2 and a molecular weight of 428.46 g/mol. Its IUPAC name is 9-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 9-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 20743956 |
| Molecular Formula | C21H30F6O2 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 9-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CCOCOC(CC1CC2CC1C1C3CC(C(C)C3C)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H30F6O2/c1-4-28-9-29-19(20(22,23)24,21(25,26)27)8-13-5-12-6-16(13)18-15-7-14(17(12)18)10(2)11(15)3/h10-18H,4-9H2,1-3H3 |
| InChIKey | ZXFQVBWRWFSNOM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|