C17H21F9O3 — CID 20743959
tert-butyl [1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-yl] carbonate (PubChem CID 20743959) has the molecular formula C17H21F9O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is tert-butyl [1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-yl] carbonate.
| Compound Name | tert-butyl [1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-yl] carbonate |
|---|---|
| PubChem CID | 20743959 |
| Molecular Formula | C17H21F9O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | tert-butyl [1,1,1,3,3,3-hexafluoro-2-(2,3,3-trifluoro-5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)propan-2-yl] carbonate |
| SMILES | CC1C(C)C2CC1C(F)(F)C2(F)C(OC(=O)OC(C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H21F9O3/c1-7-8(2)10-6-9(7)13(18,14(10,19)20)15(16(21,22)23,17(24,25)26)29-11(27)28-12(3,4)5/h7-10H,6H2,1-5H3 |
| InChIKey | HQVYOEAUBGMOLI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |