C22H21NO — CID 20744344
(E)-3-(2-methylphenyl)-N-(1-naphthalen-2-ylethyl)prop-2-enamide (PubChem CID 20744344) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (E)-3-(2-methylphenyl)-N-(1-naphthalen-2-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-methylphenyl)-N-(1-naphthalen-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 20744344 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (E)-3-(2-methylphenyl)-N-(1-naphthalen-2-ylethyl)prop-2-enamide |
| SMILES | Cc1ccccc1/C=C/C(=O)NC(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H21NO/c1-16-7-3-4-8-18(16)13-14-22(24)23-17(2)20-12-11-19-9-5-6-10-21(19)15-20/h3-15,17H,1-2H3,(H,23,24)/b14-13+ |
| InChIKey | AZKXEQJFENCZGR-BUHFOSPRSA-N |
| XLogP | 5.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|