C19H22O5SSi — CID 20744778
methyl [2-[[methyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl] carbonate (PubChem CID 20744778) has the molecular formula C19H22O5SSi and a molecular weight of 390.53 g/mol. Its IUPAC name is methyl [2-[[methyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl] carbonate.
| Compound Name | methyl [2-[[methyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl] carbonate |
|---|---|
| PubChem CID | 20744778 |
| Molecular Formula | C19H22O5SSi |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl [2-[[methyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl] carbonate |
| SMILES | COC(=O)OC1CSC(CO[Si](C)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C19H22O5SSi/c1-21-19(20)24-17-14-25-18(23-17)13-22-26(2,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3 |
| InChIKey | VDRWASVBFGNVKU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|