About methyl 3-hydroxy-3,7-dimethyloct-6-enoate
methyl 3-hydroxy-3,7-dimethyloct-6-enoate (PubChem CID 20744966) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is methyl 3-hydroxy-3,7-dimethyloct-6-enoate.
Molecular Properties
| Compound Name | methyl 3-hydroxy-3,7-dimethyloct-6-enoate |
| PubChem CID | 20744966 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | methyl 3-hydroxy-3,7-dimethyloct-6-enoate |
| SMILES | COC(=O)CC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C11H20O3/c1-9(2)6-5-7-11(3,13)8-10(12)14-4/h6,13H,5,7-8H2,1-4H3 |
| InChIKey | AZYCUHYELMASNW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-hydroxy-3,7-dimethyloct-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxy-3,7-dimethyloct-6-enoate?
The IUPAC name of methyl 3-hydroxy-3,7-dimethyloct-6-enoate (CID 20744966) is methyl 3-hydroxy-3,7-dimethyloct-6-enoate.
What is the SMILES notation for methyl 3-hydroxy-3,7-dimethyloct-6-enoate?
The canonical SMILES for methyl 3-hydroxy-3,7-dimethyloct-6-enoate is COC(=O)CC(C)(O)CCC=C(C)C.
What is the InChIKey of methyl 3-hydroxy-3,7-dimethyloct-6-enoate?
The InChIKey is AZYCUHYELMASNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-9(2)6-5-7-11(3,13)8-10(12)14-4/h6,13H,5,7-8H2,1-4H3.
What are the key properties of methyl 3-hydroxy-3,7-dimethyloct-6-enoate?
methyl 3-hydroxy-3,7-dimethyloct-6-enoate has a molecular weight of 200.28 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-3,7-dimethyloct-6-enoate is sourced from PubChem (CID 20744966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).