About 4,5-ditert-butyl-1,3-oxathiolan-2-one
4,5-ditert-butyl-1,3-oxathiolan-2-one (PubChem CID 20744982) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is 4,5-ditert-butyl-1,3-oxathiolan-2-one.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-1,3-oxathiolan-2-one |
| PubChem CID | 20744982 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 4,5-ditert-butyl-1,3-oxathiolan-2-one |
| SMILES | CC(C)(C)C1OC(=O)SC1C(C)(C)C |
| InChI | InChI=1S/C11H20O2S/c1-10(2,3)7-8(11(4,5)6)14-9(12)13-7/h7-8H,1-6H3 |
| InChIKey | DFXLCAYIPPUOLA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4,5-ditert-butyl-1,3-oxathiolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-1,3-oxathiolan-2-one?
The IUPAC name of 4,5-ditert-butyl-1,3-oxathiolan-2-one (CID 20744982) is 4,5-ditert-butyl-1,3-oxathiolan-2-one.
What is the SMILES notation for 4,5-ditert-butyl-1,3-oxathiolan-2-one?
The canonical SMILES for 4,5-ditert-butyl-1,3-oxathiolan-2-one is CC(C)(C)C1OC(=O)SC1C(C)(C)C.
What is the InChIKey of 4,5-ditert-butyl-1,3-oxathiolan-2-one?
The InChIKey is DFXLCAYIPPUOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c1-10(2,3)7-8(11(4,5)6)14-9(12)13-7/h7-8H,1-6H3.
What are the key properties of 4,5-ditert-butyl-1,3-oxathiolan-2-one?
4,5-ditert-butyl-1,3-oxathiolan-2-one has a molecular weight of 216.35 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-1,3-oxathiolan-2-one is sourced from PubChem (CID 20744982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).