C14H30N2 — CID 20745008
1,2,2,3,3,4,5,5,6,6-decamethylpiperazine (PubChem CID 20745008) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,5,6,6-decamethylpiperazine.
| Compound Name | 1,2,2,3,3,4,5,5,6,6-decamethylpiperazine |
|---|---|
| PubChem CID | 20745008 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1,2,2,3,3,4,5,5,6,6-decamethylpiperazine |
| SMILES | CN1C(C)(C)C(C)(C)N(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H30N2/c1-11(2)12(3,4)16(10)14(7,8)13(5,6)15(11)9/h1-10H3 |
| InChIKey | FSVONHLROYGQOW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |