C15H26N6O6 — CID 20745580
N-acetyl-N-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]acetamide (PubChem CID 20745580) has the molecular formula C15H26N6O6 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-acetyl-N-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]acetamide.
| Compound Name | N-acetyl-N-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]acetamide |
|---|---|
| PubChem CID | 20745580 |
| Molecular Formula | C15H26N6O6 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-acetyl-N-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]acetamide |
| SMILES | COCN(COC)c1nc(N(COC)COC)nc(N(C(C)=O)C(C)=O)n1 |
| InChI | InChI=1S/C15H26N6O6/c1-11(22)21(12(2)23)15-17-13(19(7-24-3)8-25-4)16-14(18-15)20(9-26-5)10-27-6/h7-10H2,1-6H3 |
| InChIKey | IQRBGWWYFHHTKD-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 119.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|