About 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine
4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine (PubChem CID 20745773) has the molecular formula C9H17N5O2
and a molecular weight of 227.27 g/mol. Its IUPAC name is 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine.
Molecular Properties
| Compound Name | 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine |
| PubChem CID | 20745773 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine |
| SMILES | CNCCNc1nc(OC)c(N)c(OC)n1 |
| InChI | InChI=1S/C9H17N5O2/c1-11-4-5-12-9-13-7(15-2)6(10)8(14-9)16-3/h11H,4-5,10H2,1-3H3,(H,12,13,14) |
| InChIKey | FWMAQNXRPPADNX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine?
The IUPAC name of 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine (CID 20745773) is 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine.
What is the SMILES notation for 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine?
The canonical SMILES for 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine is CNCCNc1nc(OC)c(N)c(OC)n1.
What is the InChIKey of 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine?
The InChIKey is FWMAQNXRPPADNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5O2/c1-11-4-5-12-9-13-7(15-2)6(10)8(14-9)16-3/h11H,4-5,10H2,1-3H3,(H,12,13,14).
What are the key properties of 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine?
4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine has a molecular weight of 227.27 g/mol, XLogP of -0.29, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-2-N-[2-(methylamino)ethyl]pyrimidine-2,5-diamine is sourced from PubChem (CID 20745773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).