About 5-amino-2-methyl-1,3-thiazole-4-carbonitrile
5-amino-2-methyl-1,3-thiazole-4-carbonitrile (PubChem CID 20745813) has the molecular formula C5H5N3S
and a molecular weight of 139.18 g/mol. Its IUPAC name is 5-amino-2-methyl-1,3-thiazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-2-methyl-1,3-thiazole-4-carbonitrile |
| PubChem CID | 20745813 |
| Molecular Formula | C5H5N3S |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | 5-amino-2-methyl-1,3-thiazole-4-carbonitrile |
| SMILES | Cc1nc(C#N)c(N)s1 |
| InChI | InChI=1S/C5H5N3S/c1-3-8-4(2-6)5(7)9-3/h7H2,1H3 |
| InChIKey | CCNOBBUJPWLYMB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-2-methyl-1,3-thiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-methyl-1,3-thiazole-4-carbonitrile?
The IUPAC name of 5-amino-2-methyl-1,3-thiazole-4-carbonitrile (CID 20745813) is 5-amino-2-methyl-1,3-thiazole-4-carbonitrile.
What is the SMILES notation for 5-amino-2-methyl-1,3-thiazole-4-carbonitrile?
The canonical SMILES for 5-amino-2-methyl-1,3-thiazole-4-carbonitrile is Cc1nc(C#N)c(N)s1.
What is the InChIKey of 5-amino-2-methyl-1,3-thiazole-4-carbonitrile?
The InChIKey is CCNOBBUJPWLYMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3S/c1-3-8-4(2-6)5(7)9-3/h7H2,1H3.
What are the key properties of 5-amino-2-methyl-1,3-thiazole-4-carbonitrile?
5-amino-2-methyl-1,3-thiazole-4-carbonitrile has a molecular weight of 139.18 g/mol, XLogP of 0.91, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-methyl-1,3-thiazole-4-carbonitrile is sourced from PubChem (CID 20745813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).