About 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine
2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine (PubChem CID 20745814) has the molecular formula C7H8N4S
and a molecular weight of 180.24 g/mol. Its IUPAC name is 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine.
Molecular Properties
| Compound Name | 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine |
| PubChem CID | 20745814 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine |
| SMILES | CC1=NCc2c(N)ncnc2S1 |
| InChI | InChI=1S/C7H8N4S/c1-4-9-2-5-6(8)10-3-11-7(5)12-4/h3H,2H2,1H3,(H2,8,10,11) |
| InChIKey | TWBRFGKKBVUGIS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine?
The IUPAC name of 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine (CID 20745814) is 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine.
What is the SMILES notation for 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine?
The canonical SMILES for 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine is CC1=NCc2c(N)ncnc2S1.
What is the InChIKey of 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine?
The InChIKey is TWBRFGKKBVUGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S/c1-4-9-2-5-6(8)10-3-11-7(5)12-4/h3H,2H2,1H3,(H2,8,10,11).
What are the key properties of 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine?
2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine has a molecular weight of 180.24 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4H-pyrimido[5,4-e][1,3]thiazin-5-amine is sourced from PubChem (CID 20745814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).