About 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol
4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 20745825) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol.
Molecular Properties
| Compound Name | 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol |
| PubChem CID | 20745825 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | Oc1ccc(N=C=S)c2c1CCCC2 |
| InChI | InChI=1S/C11H11NOS/c13-11-6-5-10(12-7-14)8-3-1-2-4-9(8)11/h5-6,13H,1-4H2 |
| InChIKey | RWZBFNOVEOLLEB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol?
The IUPAC name of 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol (CID 20745825) is 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol.
What is the SMILES notation for 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol?
The canonical SMILES for 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol is Oc1ccc(N=C=S)c2c1CCCC2.
What is the InChIKey of 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol?
The InChIKey is RWZBFNOVEOLLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS/c13-11-6-5-10(12-7-14)8-3-1-2-4-9(8)11/h5-6,13H,1-4H2.
What are the key properties of 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol?
4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol has a molecular weight of 205.28 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isothiocyanato-5,6,7,8-tetrahydronaphthalen-1-ol is sourced from PubChem (CID 20745825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).