About (3S,4R)-3,4-dimethoxypyrrolidine
(3S,4R)-3,4-dimethoxypyrrolidine (PubChem CID 20745983) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is (3S,4R)-3,4-dimethoxypyrrolidine.
Molecular Properties
| Compound Name | (3S,4R)-3,4-dimethoxypyrrolidine |
| PubChem CID | 20745983 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3S,4R)-3,4-dimethoxypyrrolidine |
| SMILES | CO[C@H]1CNC[C@H]1OC |
| InChI | InChI=1S/C6H13NO2/c1-8-5-3-7-4-6(5)9-2/h5-7H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | CROOPTGQTSCWCM-OLQVQODUSA-N |
| XLogP | -0.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-3,4-dimethoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3,4-dimethoxypyrrolidine?
The IUPAC name of (3S,4R)-3,4-dimethoxypyrrolidine (CID 20745983) is (3S,4R)-3,4-dimethoxypyrrolidine.
What is the SMILES notation for (3S,4R)-3,4-dimethoxypyrrolidine?
The canonical SMILES for (3S,4R)-3,4-dimethoxypyrrolidine is CO[C@H]1CNC[C@H]1OC.
What is the InChIKey of (3S,4R)-3,4-dimethoxypyrrolidine?
The InChIKey is CROOPTGQTSCWCM-OLQVQODUSA-N. The full InChI is InChI=1S/C6H13NO2/c1-8-5-3-7-4-6(5)9-2/h5-7H,3-4H2,1-2H3/t5-,6+.
What are the key properties of (3S,4R)-3,4-dimethoxypyrrolidine?
(3S,4R)-3,4-dimethoxypyrrolidine has a molecular weight of 131.18 g/mol, XLogP of -0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3,4-dimethoxypyrrolidine is sourced from PubChem (CID 20745983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).